C12H12F3NO3 — CID 63688513
2-[ethyl(formyl)amino]-2-[3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 63688513) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-[ethyl(formyl)amino]-2-[3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[ethyl(formyl)amino]-2-[3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 63688513 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[ethyl(formyl)amino]-2-[3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | CCN(C=O)C(C(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO3/c1-2-16(7-17)10(11(18)19)8-4-3-5-9(6-8)12(13,14)15/h3-7,10H,2H2,1H3,(H,18,19) |
| InChIKey | JXAKKHZWGZXMAT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|