C20H22F4N2O — CID 97028450
(2S)-2-(diethylamino)-N-(4-fluoro-2-methylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 97028450) has the molecular formula C20H22F4N2O and a molecular weight of 382.40 g/mol. Its IUPAC name is (2S)-2-(diethylamino)-N-(4-fluoro-2-methylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | (2S)-2-(diethylamino)-N-(4-fluoro-2-methylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 97028450 |
| Molecular Formula | C20H22F4N2O |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2S)-2-(diethylamino)-N-(4-fluoro-2-methylphenyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(CC)[C@H](C(=O)Nc1ccc(F)cc1C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F4N2O/c1-4-26(5-2)18(14-7-6-8-15(12-14)20(22,23)24)19(27)25-17-10-9-16(21)11-13(17)3/h6-12,18H,4-5H2,1-3H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | RSQFCCPMEUASPS-SFHVURJKSA-N |
| XLogP | 5.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |