C13H17NO6 — CID 63689458
2-[formyl(methyl)amino]-2-(3,4,5-trimethoxyphenyl)acetic acid (PubChem CID 63689458) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[formyl(methyl)amino]-2-(3,4,5-trimethoxyphenyl)acetic acid.
| Compound Name | 2-[formyl(methyl)amino]-2-(3,4,5-trimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 63689458 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[formyl(methyl)amino]-2-(3,4,5-trimethoxyphenyl)acetic acid |
| SMILES | COc1cc(C(C(=O)O)N(C)C=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO6/c1-14(7-15)11(13(16)17)8-5-9(18-2)12(20-4)10(6-8)19-3/h5-7,11H,1-4H3,(H,16,17) |
| InChIKey | VHAGULZBWOYMSI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|