C16H23NO6 — CID 143609339
2-[formyl(methyl)amino]-3-(2,4,6-trimethoxyphenyl)pentanoic acid (PubChem CID 143609339) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-[formyl(methyl)amino]-3-(2,4,6-trimethoxyphenyl)pentanoic acid.
| Compound Name | 2-[formyl(methyl)amino]-3-(2,4,6-trimethoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 143609339 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[formyl(methyl)amino]-3-(2,4,6-trimethoxyphenyl)pentanoic acid |
| SMILES | CCC(c1c(OC)cc(OC)cc1OC)C(C(=O)O)N(C)C=O |
| InChI | InChI=1S/C16H23NO6/c1-6-11(15(16(19)20)17(2)9-18)14-12(22-4)7-10(21-3)8-13(14)23-5/h7-9,11,15H,6H2,1-5H3,(H,19,20) |
| InChIKey | NDANVRKHPFYGOZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|