C12H14Cl3NO — CID 55048250
2-chloro-2-(2,6-dichlorophenyl)-N,N-diethylacetamide (PubChem CID 55048250) has the molecular formula C12H14Cl3NO and a molecular weight of 294.61 g/mol. Its IUPAC name is 2-chloro-2-(2,6-dichlorophenyl)-N,N-diethylacetamide.
| Compound Name | 2-chloro-2-(2,6-dichlorophenyl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 55048250 |
| Molecular Formula | C12H14Cl3NO |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-chloro-2-(2,6-dichlorophenyl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C(Cl)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl3NO/c1-3-16(4-2)12(17)11(15)10-8(13)6-5-7-9(10)14/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | PQNKWFRTBRIIDA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|