C14H21ClN2O — CID 112517449
4-amino-2-(2-chlorophenyl)-N,N-diethylbutanamide (PubChem CID 112517449) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-amino-2-(2-chlorophenyl)-N,N-diethylbutanamide.
| Compound Name | 4-amino-2-(2-chlorophenyl)-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 112517449 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-amino-2-(2-chlorophenyl)-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)C(CCN)c1ccccc1Cl |
| InChI | InChI=1S/C14H21ClN2O/c1-3-17(4-2)14(18)12(9-10-16)11-7-5-6-8-13(11)15/h5-8,12H,3-4,9-10,16H2,1-2H3 |
| InChIKey | LLSDFHLRPUJHDT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |