C13H18ClNO3 — CID 145375044
carbamic acid;3-(2-chlorophenyl)hexan-2-one (PubChem CID 145375044) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is carbamic acid;3-(2-chlorophenyl)hexan-2-one.
| Compound Name | carbamic acid;3-(2-chlorophenyl)hexan-2-one |
|---|---|
| PubChem CID | 145375044 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | carbamic acid;3-(2-chlorophenyl)hexan-2-one |
| SMILES | CCCC(C(C)=O)c1ccccc1Cl.NC(=O)O |
| InChI | InChI=1S/C12H15ClO.CH3NO2/c1-3-6-10(9(2)14)11-7-4-5-8-12(11)13;2-1(3)4/h4-5,7-8,10H,3,6H2,1-2H3;2H2,(H,3,4) |
| InChIKey | PBPHWTJZTPVQNH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |