C16H23Cl2N3O — CID 83977846
2-(2,6-dichlorophenyl)-N,N-diethyl-2-piperazin-1-ylacetamide (PubChem CID 83977846) has the molecular formula C16H23Cl2N3O and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N,N-diethyl-2-piperazin-1-ylacetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N,N-diethyl-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 83977846 |
| Molecular Formula | C16H23Cl2N3O |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N,N-diethyl-2-piperazin-1-ylacetamide |
| SMILES | CCN(CC)C(=O)C(c1c(Cl)cccc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C16H23Cl2N3O/c1-3-20(4-2)16(22)15(21-10-8-19-9-11-21)14-12(17)6-5-7-13(14)18/h5-7,15,19H,3-4,8-11H2,1-2H3 |
| InChIKey | ATQMDSVTJYKCRQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |