C12H14ClF2NO — CID 106531991
2-chloro-2-(3,5-difluorophenyl)-N,N-diethylacetamide (PubChem CID 106531991) has the molecular formula C12H14ClF2NO and a molecular weight of 261.70 g/mol. Its IUPAC name is 2-chloro-2-(3,5-difluorophenyl)-N,N-diethylacetamide.
| Compound Name | 2-chloro-2-(3,5-difluorophenyl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 106531991 |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-chloro-2-(3,5-difluorophenyl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)C(Cl)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H14ClF2NO/c1-3-16(4-2)12(17)11(13)8-5-9(14)7-10(15)6-8/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | KAUIGYWPDCNYHP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|