C21H21Cl2F2NO — CID 54352483
N-but-2-enyl-2-chloro-N-(4-chloro-3-propan-2-ylphenyl)-2-(3,5-difluorophenyl)acetamide (PubChem CID 54352483) has the molecular formula C21H21Cl2F2NO and a molecular weight of 412.31 g/mol. Its IUPAC name is N-but-2-enyl-2-chloro-N-(4-chloro-3-propan-2-ylphenyl)-2-(3,5-difluorophenyl)acetamide.
| Compound Name | N-but-2-enyl-2-chloro-N-(4-chloro-3-propan-2-ylphenyl)-2-(3,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 54352483 |
| Molecular Formula | C21H21Cl2F2NO |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-but-2-enyl-2-chloro-N-(4-chloro-3-propan-2-ylphenyl)-2-(3,5-difluorophenyl)acetamide |
| SMILES | CC=CCN(C(=O)C(Cl)c1cc(F)cc(F)c1)c1ccc(Cl)c(C(C)C)c1 |
| InChI | InChI=1S/C21H21Cl2F2NO/c1-4-5-8-26(17-6-7-19(22)18(12-17)13(2)3)21(27)20(23)14-9-15(24)11-16(25)10-14/h4-7,9-13,20H,8H2,1-3H3 |
| InChIKey | UGTBDIPLZRTBFR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|