C19H19N3O3 — CID 39856169
N-[4-[[(1-cyanocyclopentanecarbonyl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 39856169) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[4-[[(1-cyanocyclopentanecarbonyl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(1-cyanocyclopentanecarbonyl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39856169 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[4-[[(1-cyanocyclopentanecarbonyl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | N#CC1(C(=O)NCc2ccc(NC(=O)c3ccco3)cc2)CCCC1 |
| InChI | InChI=1S/C19H19N3O3/c20-13-19(9-1-2-10-19)18(24)21-12-14-5-7-15(8-6-14)22-17(23)16-4-3-11-25-16/h3-8,11H,1-2,9-10,12H2,(H,21,24)(H,22,23) |
| InChIKey | WOIARQLZAGLDNF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |