C10H9ClF5N — CID 103529399
N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529399) has the molecular formula C10H9ClF5N and a molecular weight of 273.63 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529399 |
| Molecular Formula | C10H9ClF5N |
| Molecular Weight | 273.63 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | Fc1ccc(CNCC(F)(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C10H9ClF5N/c11-7-3-6(1-2-8(7)12)4-17-5-10(15,16)9(13)14/h1-3,9,17H,4-5H2 |
| InChIKey | OKVXDTHJTKVDCF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.63 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|