C12H12ClF4NO2 — CID 103529488
N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 103529488) has the molecular formula C12H12ClF4NO2 and a molecular weight of 313.68 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 103529488 |
| Molecular Formula | C12H12ClF4NO2 |
| Molecular Weight | 313.68 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | FC(F)C(F)(F)CNCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C12H12ClF4NO2/c13-8-3-7(4-9-10(8)20-2-1-19-9)5-18-6-12(16,17)11(14)15/h3-4,11,18H,1-2,5-6H2 |
| InChIKey | UJJQVWVLPGIVAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|