C14H17ClF3NO2 — CID 79037114
N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 79037114) has the molecular formula C14H17ClF3NO2 and a molecular weight of 323.74 g/mol. Its IUPAC name is N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 79037114 |
| Molecular Formula | C14H17ClF3NO2 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | FC(F)(F)CCCNCc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C14H17ClF3NO2/c15-11-7-10(9-19-4-1-3-14(16,17)18)8-12-13(11)21-6-2-5-20-12/h7-8,19H,1-6,9H2 |
| InChIKey | ZHEXTGVYGNFZGK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|