C14H20ClNO4 — CID 103992734
2-[3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propoxy]ethanol (PubChem CID 103992734) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is 2-[3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propoxy]ethanol.
| Compound Name | 2-[3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propoxy]ethanol |
|---|---|
| PubChem CID | 103992734 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[3-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methylamino]propoxy]ethanol |
| SMILES | OCCOCCCNCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C14H20ClNO4/c15-12-8-11(9-13-14(12)20-7-6-19-13)10-16-2-1-4-18-5-3-17/h8-9,16-17H,1-7,10H2 |
| InChIKey | VHQZUTHNFUEFIA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|