C17H26ClN3O4 — CID 111405075
1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine (PubChem CID 111405075) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111405075 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCCOC)NCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C17H26ClN3O4/c1-19-17(20-4-3-5-23-7-6-22-2)21-12-13-10-14(18)16-15(11-13)24-8-9-25-16/h10-11H,3-9,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | CNSUOHHVBWUGST-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|