C22H29ClIN3O5 — CID 111376263
1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111376263) has the molecular formula C22H29ClIN3O5 and a molecular weight of 577.85 g/mol. Its IUPAC name is 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111376263 |
| Molecular Formula | C22H29ClIN3O5 |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-2-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(Cl)c2c(c1)OCCO2)NCc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C22H28ClN3O5.HI/c1-24-22(26-13-15-11-17(27-2)21(29-4)18(12-15)28-3)25-6-5-14-9-16(23)20-19(10-14)30-7-8-31-20;/h9-12H,5-8,13H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | POKGKWVFCOZHCA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|