C19H23ClIN3O2 — CID 111245032
1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111245032) has the molecular formula C19H23ClIN3O2 and a molecular weight of 487.77 g/mol. Its IUPAC name is 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111245032 |
| Molecular Formula | C19H23ClIN3O2 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C)cc1)NCc1cc(Cl)c2c(c1)OCCO2.I |
| InChI | InChI=1S/C19H22ClN3O2.HI/c1-13-3-5-14(6-4-13)11-22-19(21-2)23-12-15-9-16(20)18-17(10-15)24-7-8-25-18;/h3-6,9-10H,7-8,11-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | URJQKRIXTGSAPX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|