C18H24ClN5O2 — CID 111952613
1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111952613) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111952613 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cc(Cl)c2c(c1)OCCO2)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C18H24ClN5O2/c1-11-14(12(2)24(4)23-11)10-22-18(20-3)21-9-13-7-15(19)17-16(8-13)25-5-6-26-17/h7-8H,5-6,9-10H2,1-4H3,(H2,20,21,22) |
| InChIKey | XARUVUVJYCTGBB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|