C20H28ClN5O2 — CID 111278943
1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine (PubChem CID 111278943) has the molecular formula C20H28ClN5O2 and a molecular weight of 405.93 g/mol. Its IUPAC name is 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111278943 |
| Molecular Formula | C20H28ClN5O2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C20H28ClN5O2/c1-14-11-15(2)26(25-14)8-4-6-23-20(22-3)24-7-5-16-12-17(21)19-18(13-16)27-9-10-28-19/h11-13H,4-10H2,1-3H3,(H2,22,23,24) |
| InChIKey | XWTGGZJLZHBOPP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|