C19H28IN5O2 — CID 111280254
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111280254) has the molecular formula C19H28IN5O2 and a molecular weight of 485.37 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111280254 |
| Molecular Formula | C19H28IN5O2 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C19H27N5O2.HI/c1-14-11-15(2)24(23-14)10-4-8-21-19(20-3)22-9-7-16-5-6-17-18(12-16)26-13-25-17;/h5-6,11-12H,4,7-10,13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | QREJHAPMIFPUEW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|