C20H29ClIN5O2 — CID 111278578
1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111278578) has the molecular formula C20H29ClIN5O2 and a molecular weight of 533.84 g/mol. Its IUPAC name is 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111278578 |
| Molecular Formula | C20H29ClIN5O2 |
| Molecular Weight | 533.84 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1cc(Cl)c2c(c1)OCCCO2.I |
| InChI | InChI=1S/C20H28ClN5O2.HI/c1-14-10-15(2)26(25-14)7-4-6-23-20(22-3)24-13-16-11-17(21)19-18(12-16)27-8-5-9-28-19;/h10-12H,4-9,13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | XXYDZZHESVIAJT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|