C17H25ClIN3O2 — CID 110991372
1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide (PubChem CID 110991372) has the molecular formula C17H25ClIN3O2 and a molecular weight of 465.76 g/mol. Its IUPAC name is 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110991372 |
| Molecular Formula | C17H25ClIN3O2 |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-cyclopentyl-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(Cl)c2c(c1)OCCCO2)NC1CCCC1.I |
| InChI | InChI=1S/C17H24ClN3O2.HI/c1-19-17(21-13-5-2-3-6-13)20-11-12-9-14(18)16-15(10-12)22-7-4-8-23-16;/h9-10,13H,2-8,11H2,1H3,(H2,19,20,21);1H |
| InChIKey | RYIHMVURXWSMPO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|