C15H21ClFN3 — CID 110959339
1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexyl-2-methylguanidine (PubChem CID 110959339) has the molecular formula C15H21ClFN3 and a molecular weight of 297.81 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexyl-2-methylguanidine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexyl-2-methylguanidine |
|---|---|
| PubChem CID | 110959339 |
| Molecular Formula | C15H21ClFN3 |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-3-cyclohexyl-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(F)c(Cl)c1)NC1CCCCC1 |
| InChI | InChI=1S/C15H21ClFN3/c1-18-15(20-12-5-3-2-4-6-12)19-10-11-7-8-14(17)13(16)9-11/h7-9,12H,2-6,10H2,1H3,(H2,18,19,20) |
| InChIKey | AWECLILNZMUKRW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|