C16H23ClIN3O2 — CID 111852257
1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111852257) has the molecular formula C16H23ClIN3O2 and a molecular weight of 451.74 g/mol. Its IUPAC name is 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111852257 |
| Molecular Formula | C16H23ClIN3O2 |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 1-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cc(Cl)c2c(c1)OCCO2)NCC1CC1.I |
| InChI | InChI=1S/C16H22ClN3O2.HI/c1-18-16(20-10-11-2-3-11)19-5-4-12-8-13(17)15-14(9-12)21-6-7-22-15;/h8-9,11H,2-7,10H2,1H3,(H2,18,19,20);1H |
| InChIKey | AQRTWPFJWQINDD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|