C22H27ClN4O3 — CID 111631788
3-[2-[[N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111631788) has the molecular formula C22H27ClN4O3 and a molecular weight of 430.94 g/mol. Its IUPAC name is 3-[2-[[N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111631788 |
| Molecular Formula | C22H27ClN4O3 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 3-[2-[[N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)NC)c1)NCCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C22H27ClN4O3/c1-24-21(28)17-5-3-4-15(12-17)6-8-26-22(25-2)27-9-7-16-13-18(23)20-19(14-16)29-10-11-30-20/h3-5,12-14H,6-11H2,1-2H3,(H,24,28)(H2,25,26,27) |
| InChIKey | KTCKZYPGTCWUJP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|