C22H29ClN4O — CID 111631550
3-[2-[[N-[2-(2-chlorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide (PubChem CID 111631550) has the molecular formula C22H29ClN4O and a molecular weight of 400.95 g/mol. Its IUPAC name is 3-[2-[[N-[2-(2-chlorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[N-[2-(2-chlorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111631550 |
| Molecular Formula | C22H29ClN4O |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 3-[2-[[N-[2-(2-chlorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-N-methylbenzamide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)NC)c1)NCC(C)(C)c1ccccc1Cl |
| InChI | InChI=1S/C22H29ClN4O/c1-22(2,18-10-5-6-11-19(18)23)15-27-21(25-4)26-13-12-16-8-7-9-17(14-16)20(28)24-3/h5-11,14H,12-13,15H2,1-4H3,(H,24,28)(H2,25,26,27) |
| InChIKey | SHHLUHJHTZHRCD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|