C24H34N4O — CID 111668122
N,N-dimethyl-3-[2-[[N'-methyl-N-[2-methyl-2-(2-methylphenyl)propyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111668122) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-[2-methyl-2-(2-methylphenyl)propyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[2-methyl-2-(2-methylphenyl)propyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111668122 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[2-methyl-2-(2-methylphenyl)propyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)N(C)C)c1)NCC(C)(C)c1ccccc1C |
| InChI | InChI=1S/C24H34N4O/c1-18-10-7-8-13-21(18)24(2,3)17-27-23(25-4)26-15-14-19-11-9-12-20(16-19)22(29)28(5)6/h7-13,16H,14-15,17H2,1-6H3,(H2,25,26,27) |
| InChIKey | FAAZVECBQAXWPO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|