C24H32N4O — CID 111668658
N,N-dimethyl-3-[2-[[N'-methyl-N-[[1-(2-methylphenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111668658) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-[[1-(2-methylphenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[[1-(2-methylphenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111668658 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-[[1-(2-methylphenyl)cyclopropyl]methyl]carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCc1cccc(C(=O)N(C)C)c1)NCC1(c2ccccc2C)CC1 |
| InChI | InChI=1S/C24H32N4O/c1-18-8-5-6-11-21(18)24(13-14-24)17-27-23(25-2)26-15-12-19-9-7-10-20(16-19)22(29)28(3)4/h5-11,16H,12-15,17H2,1-4H3,(H2,25,26,27) |
| InChIKey | PSAKGXCZHWMNPA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|