C16H22BrFIN5 — CID 119151554
1-[(3-bromo-5-fluorophenyl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 119151554) has the molecular formula C16H22BrFIN5 and a molecular weight of 510.19 g/mol. Its IUPAC name is 1-[(3-bromo-5-fluorophenyl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-bromo-5-fluorophenyl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119151554 |
| Molecular Formula | C16H22BrFIN5 |
| Molecular Weight | 510.19 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | 1-[(3-bromo-5-fluorophenyl)methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(F)cc(Br)c1)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C16H21BrFN5.HI/c1-10-15(11(2)23(4)22-10)9-21-16(19-3)20-8-12-5-13(17)7-14(18)6-12;/h5-7H,8-9H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | RCBDUHFMIBXWFH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|