C19H30IN5O — CID 111952824
1-[[4-(ethoxymethyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111952824) has the molecular formula C19H30IN5O and a molecular weight of 471.39 g/mol. Its IUPAC name is 1-[[4-(ethoxymethyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(ethoxymethyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111952824 |
| Molecular Formula | C19H30IN5O |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1-[[4-(ethoxymethyl)phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCOCc1ccc(CN/C(=N/C)NCc2c(C)nn(C)c2C)cc1.I |
| InChI | InChI=1S/C19H29N5O.HI/c1-6-25-13-17-9-7-16(8-10-17)11-21-19(20-4)22-12-18-14(2)23-24(5)15(18)3;/h7-10H,6,11-13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | NTFWVKUPCOTVNW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|