C17H25N5O2S — CID 111951587
2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111951587) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111951587 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-methyl-1-[(4-methylsulfonylphenyl)methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(C)(=O)=O)cc1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C17H25N5O2S/c1-12-16(13(2)22(4)21-12)11-20-17(18-3)19-10-14-6-8-15(9-7-14)25(5,23)24/h6-9H,10-11H2,1-5H3,(H2,18,19,20) |
| InChIKey | LZZKJJNCVDFHRD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|