C24H38N6 — CID 111952805
1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111952805) has the molecular formula C24H38N6 and a molecular weight of 410.61 g/mol. Its IUPAC name is 1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111952805 |
| Molecular Formula | C24H38N6 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(CN2CC(C)CC(C)C2)cc1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C24H38N6/c1-17-11-18(2)15-30(14-17)16-22-9-7-21(8-10-22)12-26-24(25-5)27-13-23-19(3)28-29(6)20(23)4/h7-10,17-18H,11-16H2,1-6H3,(H2,25,26,27) |
| InChIKey | VNZSKFXONPAGAX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|