C12H16ClNO2S — CID 60658302
N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methylsulfanylethanamine (PubChem CID 60658302) has the molecular formula C12H16ClNO2S and a molecular weight of 273.79 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methylsulfanylethanamine.
| Compound Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 60658302 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-2-methylsulfanylethanamine |
| SMILES | CSCCNCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C12H16ClNO2S/c1-17-5-2-14-8-9-6-10(13)12-11(7-9)15-3-4-16-12/h6-7,14H,2-5,8H2,1H3 |
| InChIKey | MQMKYGJGYXOKLW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|