C16H23ClN2O2 — CID 103637935
N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine (PubChem CID 103637935) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine.
| Compound Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 103637935 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-N'-cyclopropyl-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCNCc1cc(Cl)c2c(c1)OCCO2)C1CC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-2-19(13-3-4-13)6-5-18-11-12-9-14(17)16-15(10-12)20-7-8-21-16/h9-10,13,18H,2-8,11H2,1H3 |
| InChIKey | QOHSGLVPRCJPON-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|