C18H27ClN2O3 — CID 95592449
N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanamine (PubChem CID 95592449) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanamine.
| Compound Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanamine |
|---|---|
| PubChem CID | 95592449 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethanamine |
| SMILES | C[C@H]1CN(CCNCc2cc(Cl)c3c(c2)OCCCO3)C[C@H](C)O1 |
| InChI | InChI=1S/C18H27ClN2O3/c1-13-11-21(12-14(2)24-13)5-4-20-10-15-8-16(19)18-17(9-15)22-6-3-7-23-18/h8-9,13-14,20H,3-7,10-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | HJMSZIBZDLDPHF-KBPBESRZSA-N |
| XLogP | 2.70 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|