C12H7ClF7NO — CID 71672811
N-(3-chloro-4-fluorophenyl)-2,2-bis(trifluoromethyl)but-3-enamide (PubChem CID 71672811) has the molecular formula C12H7ClF7NO and a molecular weight of 349.63 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2,2-bis(trifluoromethyl)but-3-enamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2,2-bis(trifluoromethyl)but-3-enamide |
|---|---|
| PubChem CID | 71672811 |
| Molecular Formula | C12H7ClF7NO |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2,2-bis(trifluoromethyl)but-3-enamide |
| SMILES | C=CC(C(=O)Nc1ccc(F)c(Cl)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H7ClF7NO/c1-2-10(11(15,16)17,12(18,19)20)9(22)21-6-3-4-8(14)7(13)5-6/h2-5H,1H2,(H,21,22) |
| InChIKey | LOVJPCYQWMNKLM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|