C12H11ClF4N2O2 — CID 103733189
N-[2-chloro-5-(propanoylamino)phenyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733189) has the molecular formula C12H11ClF4N2O2 and a molecular weight of 326.68 g/mol. Its IUPAC name is N-[2-chloro-5-(propanoylamino)phenyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-chloro-5-(propanoylamino)phenyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733189 |
| Molecular Formula | C12H11ClF4N2O2 |
| Molecular Weight | 326.68 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-[2-chloro-5-(propanoylamino)phenyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCC(=O)Nc1ccc(Cl)c(NC(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H11ClF4N2O2/c1-2-9(20)18-6-3-4-7(13)8(5-6)19-11(21)12(16,17)10(14)15/h3-5,10H,2H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | NLQNIGAWPJKVOE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|