C12H13ClN2O — CID 63952872
N-[4-chloro-3-(prop-2-ynylamino)phenyl]propanamide (PubChem CID 63952872) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is N-[4-chloro-3-(prop-2-ynylamino)phenyl]propanamide.
| Compound Name | N-[4-chloro-3-(prop-2-ynylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 63952872 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | N-[4-chloro-3-(prop-2-ynylamino)phenyl]propanamide |
| SMILES | C#CCNc1cc(NC(=O)CC)ccc1Cl |
| InChI | InChI=1S/C12H13ClN2O/c1-3-7-14-11-8-9(5-6-10(11)13)15-12(16)4-2/h1,5-6,8,14H,4,7H2,2H3,(H,15,16) |
| InChIKey | PXFFAPOVGJADEG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|