C14H16ClN3O2 — CID 79287636
N-[4-chloro-3-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]propanamide (PubChem CID 79287636) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is N-[4-chloro-3-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]propanamide.
| Compound Name | N-[4-chloro-3-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 79287636 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-[4-chloro-3-[[2-(prop-2-ynylamino)acetyl]amino]phenyl]propanamide |
| SMILES | C#CCNCC(=O)Nc1cc(NC(=O)CC)ccc1Cl |
| InChI | InChI=1S/C14H16ClN3O2/c1-3-7-16-9-14(20)18-12-8-10(5-6-11(12)15)17-13(19)4-2/h1,5-6,8,16H,4,7,9H2,2H3,(H,17,19)(H,18,20) |
| InChIKey | JQNQTRXTSQWABV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|