C14H17ClN2O2 — CID 79286490
N-(3-chloro-4-propoxyphenyl)-2-(prop-2-ynylamino)acetamide (PubChem CID 79286490) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is N-(3-chloro-4-propoxyphenyl)-2-(prop-2-ynylamino)acetamide.
| Compound Name | N-(3-chloro-4-propoxyphenyl)-2-(prop-2-ynylamino)acetamide |
|---|---|
| PubChem CID | 79286490 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-(3-chloro-4-propoxyphenyl)-2-(prop-2-ynylamino)acetamide |
| SMILES | C#CCNCC(=O)Nc1ccc(OCCC)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2O2/c1-3-7-16-10-14(18)17-11-5-6-13(12(15)9-11)19-8-4-2/h1,5-6,9,16H,4,7-8,10H2,2H3,(H,17,18) |
| InChIKey | UMYNYDPITPSKSY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|