C18H26ClNO3 — CID 100712883
N-(3-chloro-4-propoxyphenyl)-1-propoxycyclopentane-1-carboxamide (PubChem CID 100712883) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is N-(3-chloro-4-propoxyphenyl)-1-propoxycyclopentane-1-carboxamide.
| Compound Name | N-(3-chloro-4-propoxyphenyl)-1-propoxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100712883 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-(3-chloro-4-propoxyphenyl)-1-propoxycyclopentane-1-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2(OCCC)CCCC2)cc1Cl |
| InChI | InChI=1S/C18H26ClNO3/c1-3-11-22-16-8-7-14(13-15(16)19)20-17(21)18(23-12-4-2)9-5-6-10-18/h7-8,13H,3-6,9-12H2,1-2H3,(H,20,21) |
| InChIKey | HVUXGLOZBUKUIZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |