C22H25Cl2NO2 — CID 100675916
1-(4-chlorophenyl)-N-(3-chloro-4-propoxyphenyl)cyclohexane-1-carboxamide (PubChem CID 100675916) has the molecular formula C22H25Cl2NO2 and a molecular weight of 406.35 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3-chloro-4-propoxyphenyl)cyclohexane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(3-chloro-4-propoxyphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100675916 |
| Molecular Formula | C22H25Cl2NO2 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3-chloro-4-propoxyphenyl)cyclohexane-1-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)C2(c3ccc(Cl)cc3)CCCCC2)cc1Cl |
| InChI | InChI=1S/C22H25Cl2NO2/c1-2-14-27-20-11-10-18(15-19(20)24)25-21(26)22(12-4-3-5-13-22)16-6-8-17(23)9-7-16/h6-11,15H,2-5,12-14H2,1H3,(H,25,26) |
| InChIKey | IYXOTMLEJWAGSJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |