C23H25ClN2O2 — CID 100722065
N-(4-butoxy-3-cyanophenyl)-1-(4-chlorophenyl)cyclopentane-1-carboxamide (PubChem CID 100722065) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-(4-butoxy-3-cyanophenyl)-1-(4-chlorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-(4-butoxy-3-cyanophenyl)-1-(4-chlorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100722065 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-(4-butoxy-3-cyanophenyl)-1-(4-chlorophenyl)cyclopentane-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)C2(c3ccc(Cl)cc3)CCCC2)cc1C#N |
| InChI | InChI=1S/C23H25ClN2O2/c1-2-3-14-28-21-11-10-20(15-17(21)16-25)26-22(27)23(12-4-5-13-23)18-6-8-19(24)9-7-18/h6-11,15H,2-5,12-14H2,1H3,(H,26,27) |
| InChIKey | ZIAMSRSTGDGWMX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|