C22H22N2O3 — CID 100720556
[2-cyano-4-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]phenyl] acetate (PubChem CID 100720556) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is [2-cyano-4-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]phenyl] acetate.
| Compound Name | [2-cyano-4-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]phenyl] acetate |
|---|---|
| PubChem CID | 100720556 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [2-cyano-4-[[1-(4-methylphenyl)cyclopentanecarbonyl]amino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(NC(=O)C2(c3ccc(C)cc3)CCCC2)cc1C#N |
| InChI | InChI=1S/C22H22N2O3/c1-15-5-7-18(8-6-15)22(11-3-4-12-22)21(26)24-19-9-10-20(27-16(2)25)17(13-19)14-23/h5-10,13H,3-4,11-12H2,1-2H3,(H,24,26) |
| InChIKey | XLKHJZVEHGUZCP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|