C20H26N2O4 — CID 100767545
[2-cyano-4-[(1-propoxycycloheptanecarbonyl)amino]phenyl] acetate (PubChem CID 100767545) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-cyano-4-[(1-propoxycycloheptanecarbonyl)amino]phenyl] acetate.
| Compound Name | [2-cyano-4-[(1-propoxycycloheptanecarbonyl)amino]phenyl] acetate |
|---|---|
| PubChem CID | 100767545 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [2-cyano-4-[(1-propoxycycloheptanecarbonyl)amino]phenyl] acetate |
| SMILES | CCCOC1(C(=O)Nc2ccc(OC(C)=O)c(C#N)c2)CCCCCC1 |
| InChI | InChI=1S/C20H26N2O4/c1-3-12-25-20(10-6-4-5-7-11-20)19(24)22-17-8-9-18(26-15(2)23)16(13-17)14-21/h8-9,13H,3-7,10-12H2,1-2H3,(H,22,24) |
| InChIKey | YJVXJERPVFBKET-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|