C19H24N2O4 — CID 100767323
[2-cyano-4-[(1-propoxycyclohexanecarbonyl)amino]phenyl] acetate (PubChem CID 100767323) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2-cyano-4-[(1-propoxycyclohexanecarbonyl)amino]phenyl] acetate.
| Compound Name | [2-cyano-4-[(1-propoxycyclohexanecarbonyl)amino]phenyl] acetate |
|---|---|
| PubChem CID | 100767323 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [2-cyano-4-[(1-propoxycyclohexanecarbonyl)amino]phenyl] acetate |
| SMILES | CCCOC1(C(=O)Nc2ccc(OC(C)=O)c(C#N)c2)CCCCC1 |
| InChI | InChI=1S/C19H24N2O4/c1-3-11-24-19(9-5-4-6-10-19)18(23)21-16-7-8-17(25-14(2)22)15(12-16)13-20/h7-8,12H,3-6,9-11H2,1-2H3,(H,21,23) |
| InChIKey | HWTSTRMYVRAWOG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|