C8H7F4N3S — CID 51000207
1-amino-3-[2-fluoro-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 51000207) has the molecular formula C8H7F4N3S and a molecular weight of 253.22 g/mol. Its IUPAC name is 1-amino-3-[2-fluoro-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-amino-3-[2-fluoro-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 51000207 |
| Molecular Formula | C8H7F4N3S |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 1-amino-3-[2-fluoro-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | NNC(=S)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C8H7F4N3S/c9-5-2-1-4(8(10,11)12)3-6(5)14-7(16)15-13/h1-3H,13H2,(H2,14,15,16) |
| InChIKey | KWNZINGIWXHGFQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|