C12H14F3NO3 — CID 79673463
N-(2-methoxyethoxy)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 79673463) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2-methoxyethoxy)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 79673463 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(2-methoxyethoxy)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCONC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO3/c1-18-6-7-19-16-11(17)8-9-2-4-10(5-3-9)12(13,14)15/h2-5H,6-8H2,1H3,(H,16,17) |
| InChIKey | VEFPIOUYKCVXSO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|