C17H22F3NO2 — CID 91776931
N-[[1-(methoxymethyl)cyclopentyl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 91776931) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[[1-(methoxymethyl)cyclopentyl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[[1-(methoxymethyl)cyclopentyl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91776931 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[[1-(methoxymethyl)cyclopentyl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCC1(CNC(=O)Cc2ccc(C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C17H22F3NO2/c1-23-12-16(8-2-3-9-16)11-21-15(22)10-13-4-6-14(7-5-13)17(18,19)20/h4-7H,2-3,8-12H2,1H3,(H,21,22) |
| InChIKey | YURJVAYUPFBHFO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |